C25H32N4O5S — CID 18367076
2-[butylsulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]amino]acetic acid (PubChem CID 18367076) has the molecular formula C25H32N4O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-[butylsulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]amino]acetic acid.
| Compound Name | 2-[butylsulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]amino]acetic acid |
|---|---|
| PubChem CID | 18367076 |
| Molecular Formula | C25H32N4O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-[butylsulfonyl-[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]amino]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCCc3cc(N(CC(=O)O)S(=O)(=O)CCCC)ccc32)cc1 |
| InChI | InChI=1S/C25H32N4O5S/c1-2-3-15-35(33,34)29(17-24(31)32)21-11-12-22-20(16-21)5-4-14-28(22)23(30)13-8-18-6-9-19(10-7-18)25(26)27/h6-7,9-12,16H,2-5,8,13-15,17H2,1H3,(H3,26,27)(H,31,32) |
| InChIKey | YGCASUUDGYQZMT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|