C17H15NO3 — CID 18367429
1-(4,5-diphenyl-1,3-oxazol-2-yl)ethane-1,2-diol (PubChem CID 18367429) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(4,5-diphenyl-1,3-oxazol-2-yl)ethane-1,2-diol.
| Compound Name | 1-(4,5-diphenyl-1,3-oxazol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 18367429 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-(4,5-diphenyl-1,3-oxazol-2-yl)ethane-1,2-diol |
| SMILES | OCC(O)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H15NO3/c19-11-14(20)17-18-15(12-7-3-1-4-8-12)16(21-17)13-9-5-2-6-10-13/h1-10,14,19-20H,11H2 |
| InChIKey | UXFHNQVNXIHOAB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |