About 3,5,6-trifluoro-1,2-dihydropyridin-2-amine
3,5,6-trifluoro-1,2-dihydropyridin-2-amine (PubChem CID 18367513) has the molecular formula C5H5F3N2
and a molecular weight of 150.10 g/mol. Its IUPAC name is 3,5,6-trifluoro-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 3,5,6-trifluoro-1,2-dihydropyridin-2-amine |
| PubChem CID | 18367513 |
| Molecular Formula | C5H5F3N2 |
| Molecular Weight | 150.10 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 3,5,6-trifluoro-1,2-dihydropyridin-2-amine |
| SMILES | NC1NC(F)=C(F)C=C1F |
| InChI | InChI=1S/C5H5F3N2/c6-2-1-3(7)5(9)10-4(2)8/h1,5,10H,9H2 |
| InChIKey | PCZDGHRPACEQKC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3,5,6-trifluoro-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,6-trifluoro-1,2-dihydropyridin-2-amine?
The IUPAC name of 3,5,6-trifluoro-1,2-dihydropyridin-2-amine (CID 18367513) is 3,5,6-trifluoro-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 3,5,6-trifluoro-1,2-dihydropyridin-2-amine?
The canonical SMILES for 3,5,6-trifluoro-1,2-dihydropyridin-2-amine is NC1NC(F)=C(F)C=C1F.
What is the InChIKey of 3,5,6-trifluoro-1,2-dihydropyridin-2-amine?
The InChIKey is PCZDGHRPACEQKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3N2/c6-2-1-3(7)5(9)10-4(2)8/h1,5,10H,9H2.
What are the key properties of 3,5,6-trifluoro-1,2-dihydropyridin-2-amine?
3,5,6-trifluoro-1,2-dihydropyridin-2-amine has a molecular weight of 150.10 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,6-trifluoro-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 18367513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).