C12H20N2O7 — CID 18368421
1-[5-(2,3,4-trihydroxybutyl)pyrazin-2-yl]butane-1,1,2,2-tetrol (PubChem CID 18368421) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-[5-(2,3,4-trihydroxybutyl)pyrazin-2-yl]butane-1,1,2,2-tetrol.
| Compound Name | 1-[5-(2,3,4-trihydroxybutyl)pyrazin-2-yl]butane-1,1,2,2-tetrol |
|---|---|
| PubChem CID | 18368421 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-[5-(2,3,4-trihydroxybutyl)pyrazin-2-yl]butane-1,1,2,2-tetrol |
| SMILES | CCC(O)(O)C(O)(O)c1cnc(CC(O)C(O)CO)cn1 |
| InChI | InChI=1S/C12H20N2O7/c1-2-11(18,19)12(20,21)10-5-13-7(4-14-10)3-8(16)9(17)6-15/h4-5,8-9,15-21H,2-3,6H2,1H3 |
| InChIKey | WFJSNELRIXKILD-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|