About N-(3-hydroxypropyl)-2,2-diphenylacetamide
N-(3-hydroxypropyl)-2,2-diphenylacetamide (PubChem CID 18368821) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,2-diphenylacetamide |
| PubChem CID | 18368821 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(3-hydroxypropyl)-2,2-diphenylacetamide |
| SMILES | O=C(NCCCO)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c19-13-7-12-18-17(20)16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,19H,7,12-13H2,(H,18,20) |
| InChIKey | DOGRFNDQFDHDNY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,2-diphenylacetamide?
The IUPAC name of N-(3-hydroxypropyl)-2,2-diphenylacetamide (CID 18368821) is N-(3-hydroxypropyl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,2-diphenylacetamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,2-diphenylacetamide is O=C(NCCCO)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(3-hydroxypropyl)-2,2-diphenylacetamide?
The InChIKey is DOGRFNDQFDHDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c19-13-7-12-18-17(20)16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,19H,7,12-13H2,(H,18,20).
What are the key properties of N-(3-hydroxypropyl)-2,2-diphenylacetamide?
N-(3-hydroxypropyl)-2,2-diphenylacetamide has a molecular weight of 269.34 g/mol, XLogP of 2.32, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,2-diphenylacetamide is sourced from PubChem (CID 18368821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).