C25H21N3O5 — CID 18369357
5,6-bis(4-methoxyphenyl)-2-[(4-nitrophenyl)methyl]pyridazin-3-one (PubChem CID 18369357) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 5,6-bis(4-methoxyphenyl)-2-[(4-nitrophenyl)methyl]pyridazin-3-one.
| Compound Name | 5,6-bis(4-methoxyphenyl)-2-[(4-nitrophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 18369357 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 5,6-bis(4-methoxyphenyl)-2-[(4-nitrophenyl)methyl]pyridazin-3-one |
| SMILES | COc1ccc(-c2cc(=O)n(Cc3ccc([N+](=O)[O-])cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-32-21-11-5-18(6-12-21)23-15-24(29)27(16-17-3-9-20(10-4-17)28(30)31)26-25(23)19-7-13-22(33-2)14-8-19/h3-15H,16H2,1-2H3 |
| InChIKey | MGRMLYYSMVRZSO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|