About 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline
2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline (PubChem CID 18369600) has the molecular formula C20H25N5
and a molecular weight of 335.46 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline.
Molecular Properties
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline |
| PubChem CID | 18369600 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline |
| SMILES | CN(CCN1CCCCC1)c1ccccc1-c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C20H25N5/c1-24(14-15-25-12-5-2-6-13-25)18-10-4-3-8-16(18)19-22-17-9-7-11-21-20(17)23-19/h3-4,7-11H,2,5-6,12-15H2,1H3,(H,21,22,23) |
| InChIKey | AMOHDDXGZPNKCZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline?
The IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline (CID 18369600) is 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline.
What is the SMILES notation for 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline?
The canonical SMILES for 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline is CN(CCN1CCCCC1)c1ccccc1-c1nc2ncccc2[nH]1.
What is the InChIKey of 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline?
The InChIKey is AMOHDDXGZPNKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5/c1-24(14-15-25-12-5-2-6-13-25)18-10-4-3-8-16(18)19-22-17-9-7-11-21-20(17)23-19/h3-4,7-11H,2,5-6,12-15H2,1H3,(H,21,22,23).
What are the key properties of 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline?
2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline has a molecular weight of 335.46 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazo[4,5-b]pyridin-2-yl)-N-methyl-N-(2-piperidin-1-ylethyl)aniline is sourced from PubChem (CID 18369600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).