About ethyl (E)-2-oxohex-4-enoate
ethyl (E)-2-oxohex-4-enoate (PubChem CID 18370140) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is ethyl (E)-2-oxohex-4-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-oxohex-4-enoate |
| PubChem CID | 18370140 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | ethyl (E)-2-oxohex-4-enoate |
| SMILES | C/C=C/CC(=O)C(=O)OCC |
| InChI | InChI=1S/C8H12O3/c1-3-5-6-7(9)8(10)11-4-2/h3,5H,4,6H2,1-2H3/b5-3+ |
| InChIKey | WFVXFGWLEPOLPO-HWKANZROSA-N |
| XLogP | 1.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-oxohex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-oxohex-4-enoate?
The IUPAC name of ethyl (E)-2-oxohex-4-enoate (CID 18370140) is ethyl (E)-2-oxohex-4-enoate.
What is the SMILES notation for ethyl (E)-2-oxohex-4-enoate?
The canonical SMILES for ethyl (E)-2-oxohex-4-enoate is C/C=C/CC(=O)C(=O)OCC.
What is the InChIKey of ethyl (E)-2-oxohex-4-enoate?
The InChIKey is WFVXFGWLEPOLPO-HWKANZROSA-N. The full InChI is InChI=1S/C8H12O3/c1-3-5-6-7(9)8(10)11-4-2/h3,5H,4,6H2,1-2H3/b5-3+.
What are the key properties of ethyl (E)-2-oxohex-4-enoate?
ethyl (E)-2-oxohex-4-enoate has a molecular weight of 156.18 g/mol, XLogP of 1.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-oxohex-4-enoate is sourced from PubChem (CID 18370140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).