About benzyl 2-oxo-4-phenylbutanoate
benzyl 2-oxo-4-phenylbutanoate (PubChem CID 18370473) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is benzyl 2-oxo-4-phenylbutanoate.
Molecular Properties
| Compound Name | benzyl 2-oxo-4-phenylbutanoate |
| PubChem CID | 18370473 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | benzyl 2-oxo-4-phenylbutanoate |
| SMILES | O=C(CCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H16O3/c18-16(12-11-14-7-3-1-4-8-14)17(19)20-13-15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | PUVAQZVULKCPHQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-oxo-4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-oxo-4-phenylbutanoate?
The IUPAC name of benzyl 2-oxo-4-phenylbutanoate (CID 18370473) is benzyl 2-oxo-4-phenylbutanoate.
What is the SMILES notation for benzyl 2-oxo-4-phenylbutanoate?
The canonical SMILES for benzyl 2-oxo-4-phenylbutanoate is O=C(CCc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-oxo-4-phenylbutanoate?
The InChIKey is PUVAQZVULKCPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c18-16(12-11-14-7-3-1-4-8-14)17(19)20-13-15-9-5-2-6-10-15/h1-10H,11-13H2.
What are the key properties of benzyl 2-oxo-4-phenylbutanoate?
benzyl 2-oxo-4-phenylbutanoate has a molecular weight of 268.31 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-oxo-4-phenylbutanoate is sourced from PubChem (CID 18370473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).