About methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate
methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate (PubChem CID 18370751) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate.
Molecular Properties
| Compound Name | methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate |
| PubChem CID | 18370751 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate |
| SMILES | COC(=O)/C(CCC(C)(C)C)=N\O |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)6-5-7(10-12)8(11)13-4/h12H,5-6H2,1-4H3/b10-7- |
| InChIKey | MAOWBQDJFZQDHS-YFHOEESVSA-N |
| XLogP | 1.82 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate?
The IUPAC name of methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate (CID 18370751) is methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate.
What is the SMILES notation for methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate?
The canonical SMILES for methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate is COC(=O)/C(CCC(C)(C)C)=N\O.
What is the InChIKey of methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate?
The InChIKey is MAOWBQDJFZQDHS-YFHOEESVSA-N. The full InChI is InChI=1S/C9H17NO3/c1-9(2,3)6-5-7(10-12)8(11)13-4/h12H,5-6H2,1-4H3/b10-7-.
What are the key properties of methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate?
methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate has a molecular weight of 187.24 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-hydroxyimino-5,5-dimethylhexanoate is sourced from PubChem (CID 18370751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).