About 3-butyl-1,1-bis(2-hydroxyethyl)urea
3-butyl-1,1-bis(2-hydroxyethyl)urea (PubChem CID 18371210) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-butyl-1,1-bis(2-hydroxyethyl)urea.
Molecular Properties
| Compound Name | 3-butyl-1,1-bis(2-hydroxyethyl)urea |
| PubChem CID | 18371210 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-butyl-1,1-bis(2-hydroxyethyl)urea |
| SMILES | CCCCNC(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H20N2O3/c1-2-3-4-10-9(14)11(5-7-12)6-8-13/h12-13H,2-8H2,1H3,(H,10,14) |
| InChIKey | QFGFSRBQRAJVJS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-1,1-bis(2-hydroxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,1-bis(2-hydroxyethyl)urea?
The IUPAC name of 3-butyl-1,1-bis(2-hydroxyethyl)urea (CID 18371210) is 3-butyl-1,1-bis(2-hydroxyethyl)urea.
What is the SMILES notation for 3-butyl-1,1-bis(2-hydroxyethyl)urea?
The canonical SMILES for 3-butyl-1,1-bis(2-hydroxyethyl)urea is CCCCNC(=O)N(CCO)CCO.
What is the InChIKey of 3-butyl-1,1-bis(2-hydroxyethyl)urea?
The InChIKey is QFGFSRBQRAJVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O3/c1-2-3-4-10-9(14)11(5-7-12)6-8-13/h12-13H,2-8H2,1H3,(H,10,14).
What are the key properties of 3-butyl-1,1-bis(2-hydroxyethyl)urea?
3-butyl-1,1-bis(2-hydroxyethyl)urea has a molecular weight of 204.27 g/mol, XLogP of -0.22, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,1-bis(2-hydroxyethyl)urea is sourced from PubChem (CID 18371210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).