C19H25N3O4 — CID 18371649
1-N,1-N-bis(2-methoxyethyl)-2-(4-methyl-3-nitrophenyl)benzene-1,4-diamine (PubChem CID 18371649) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-N,1-N-bis(2-methoxyethyl)-2-(4-methyl-3-nitrophenyl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N-bis(2-methoxyethyl)-2-(4-methyl-3-nitrophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 18371649 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-N,1-N-bis(2-methoxyethyl)-2-(4-methyl-3-nitrophenyl)benzene-1,4-diamine |
| SMILES | COCCN(CCOC)c1ccc(N)cc1-c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H25N3O4/c1-14-4-5-15(12-19(14)22(23)24)17-13-16(20)6-7-18(17)21(8-10-25-2)9-11-26-3/h4-7,12-13H,8-11,20H2,1-3H3 |
| InChIKey | VXMXHHVJYKCPBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|