About 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol
2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol (PubChem CID 18371893) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol |
| PubChem CID | 18371893 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol |
| SMILES | Nc1ccc(NCC(O)CO)c(-c2cc(O)ccc2O)c1 |
| InChI | InChI=1S/C15H18N2O4/c16-9-1-3-14(17-7-11(20)8-18)12(5-9)13-6-10(19)2-4-15(13)21/h1-6,11,17-21H,7-8,16H2 |
| InChIKey | DLGBLJXXWCBOCW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol?
The IUPAC name of 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol (CID 18371893) is 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol.
What is the SMILES notation for 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol?
The canonical SMILES for 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol is Nc1ccc(NCC(O)CO)c(-c2cc(O)ccc2O)c1.
What is the InChIKey of 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol?
The InChIKey is DLGBLJXXWCBOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4/c16-9-1-3-14(17-7-11(20)8-18)12(5-9)13-6-10(19)2-4-15(13)21/h1-6,11,17-21H,7-8,16H2.
What are the key properties of 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol?
2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol has a molecular weight of 290.32 g/mol, XLogP of 1.11, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-amino-2-(2,3-dihydroxypropylamino)phenyl]benzene-1,4-diol is sourced from PubChem (CID 18371893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).