C32H56N2O6 — CID 18371956
2,2-bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid (PubChem CID 18371956) has the molecular formula C32H56N2O6 and a molecular weight of 564.81 g/mol. Its IUPAC name is 2,2-bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid.
| Compound Name | 2,2-bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 18371956 |
| Molecular Formula | C32H56N2O6 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.41 |
| IUPAC Name | 2,2-bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid |
| SMILES | CC(=O)N1C(C)(C)CC(C(CCCCCCCC(=O)O)(C(=O)O)C2CC(C)(C)N(C(C)=O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C32H56N2O6/c1-22(35)33-28(3,4)18-24(19-29(33,5)6)32(27(39)40,17-15-13-11-12-14-16-26(37)38)25-20-30(7,8)34(23(2)36)31(9,10)21-25/h24-25H,11-21H2,1-10H3,(H,37,38)(H,39,40) |
| InChIKey | ZZBAOUVLLPZFGG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|