C16H20N2O9S — CID 18372204
2,5-dioxopyrrolidine-3-sulfonic acid;4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 18372204) has the molecular formula C16H20N2O9S and a molecular weight of 416.41 g/mol. Its IUPAC name is 2,5-dioxopyrrolidine-3-sulfonic acid;4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2,5-dioxopyrrolidine-3-sulfonic acid;4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18372204 |
| Molecular Formula | C16H20N2O9S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2,5-dioxopyrrolidine-3-sulfonic acid;4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=C1CC(S(=O)(=O)O)C(=O)N1 |
| InChI | InChI=1S/C12H15NO4.C4H5NO5S/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;6-3-1-2(4(7)5-3)11(8,9)10/h5-6,8-9H,1-4,7H2,(H,16,17);2H,1H2,(H,5,6,7)(H,8,9,10) |
| InChIKey | XPKLHEGUFJWBLM-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|