C21H21NO3 — CID 18372275
2-benzoyl-5-phenylmethoxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3-one (PubChem CID 18372275) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-benzoyl-5-phenylmethoxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3-one.
| Compound Name | 2-benzoyl-5-phenylmethoxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 18372275 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-benzoyl-5-phenylmethoxy-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3-one |
| SMILES | O=C(c1ccccc1)N1CC2CC(OCc3ccccc3)CC2C1=O |
| InChI | InChI=1S/C21H21NO3/c23-20(16-9-5-2-6-10-16)22-13-17-11-18(12-19(17)21(22)24)25-14-15-7-3-1-4-8-15/h1-10,17-19H,11-14H2 |
| InChIKey | UQNYGPVONNAZOT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|