About cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride
cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride (PubChem CID 18372792) has the molecular formula C16H31ClN2O2
and a molecular weight of 318.89 g/mol. Its IUPAC name is cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride |
| PubChem CID | 18372792 |
| Molecular Formula | C16H31ClN2O2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride |
| SMILES | CCCN(C(=O)OCC1CCCCC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C16H30N2O2.ClH/c1-2-12-18(15-8-10-17-11-9-15)16(19)20-13-14-6-4-3-5-7-14;/h14-15,17H,2-13H2,1H3;1H |
| InChIKey | WHVBJFKPSLHTEJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride?
The IUPAC name of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride (CID 18372792) is cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride.
What is the SMILES notation for cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride?
The canonical SMILES for cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride is CCCN(C(=O)OCC1CCCCC1)C1CCNCC1.Cl.
What is the InChIKey of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride?
The InChIKey is WHVBJFKPSLHTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2.ClH/c1-2-12-18(15-8-10-17-11-9-15)16(19)20-13-14-6-4-3-5-7-14;/h14-15,17H,2-13H2,1H3;1H.
What are the key properties of cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride?
cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride has a molecular weight of 318.89 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl N-piperidin-4-yl-N-propylcarbamate;hydrochloride is sourced from PubChem (CID 18372792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).