About 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol
2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol (PubChem CID 18372918) has the molecular formula C16H30N2O2S
and a molecular weight of 314.50 g/mol. Its IUPAC name is 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol |
| PubChem CID | 18372918 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol |
| SMILES | CCCCCCCCCCc1cc(C(O)C(N)CO)ns1 |
| InChI | InChI=1S/C16H30N2O2S/c1-2-3-4-5-6-7-8-9-10-13-11-15(18-21-13)16(20)14(17)12-19/h11,14,16,19-20H,2-10,12,17H2,1H3 |
| InChIKey | DAJMBYYIUMFVQJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol?
The IUPAC name of 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol (CID 18372918) is 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol.
What is the SMILES notation for 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol?
The canonical SMILES for 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol is CCCCCCCCCCc1cc(C(O)C(N)CO)ns1.
What is the InChIKey of 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol?
The InChIKey is DAJMBYYIUMFVQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2S/c1-2-3-4-5-6-7-8-9-10-13-11-15(18-21-13)16(20)14(17)12-19/h11,14,16,19-20H,2-10,12,17H2,1H3.
What are the key properties of 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol?
2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol has a molecular weight of 314.50 g/mol, XLogP of 3.18, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(5-decyl-1,2-thiazol-3-yl)propane-1,3-diol is sourced from PubChem (CID 18372918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).