C8H5Cl2F3N2O4S — CID 18373573
2,6-dichloro-3-nitro-N-(1,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 18373573) has the molecular formula C8H5Cl2F3N2O4S and a molecular weight of 353.11 g/mol. Its IUPAC name is 2,6-dichloro-3-nitro-N-(1,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-3-nitro-N-(1,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18373573 |
| Molecular Formula | C8H5Cl2F3N2O4S |
| Molecular Weight | 353.11 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 2,6-dichloro-3-nitro-N-(1,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)NC(F)C(F)F)c1Cl |
| InChI | InChI=1S/C8H5Cl2F3N2O4S/c9-3-1-2-4(15(16)17)5(10)6(3)20(18,19)14-8(13)7(11)12/h1-2,7-8,14H |
| InChIKey | NPQSWTOXKVQPOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|