About 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride
3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride (PubChem CID 18373599) has the molecular formula C14H25ClN2
and a molecular weight of 256.82 g/mol. Its IUPAC name is 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride |
| PubChem CID | 18373599 |
| Molecular Formula | C14H25ClN2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C12CC3(C)CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C14H24N2.ClH/c1-11-4-12(2)6-13(3,5-11)9-14(7-11,8-12)10(15)16;/h4-9H2,1-3H3,(H3,15,16);1H |
| InChIKey | BWMOQSPTAVHWAD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride?
The IUPAC name of 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride (CID 18373599) is 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride.
What is the SMILES notation for 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride?
The canonical SMILES for 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)C12CC3(C)CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride?
The InChIKey is BWMOQSPTAVHWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2.ClH/c1-11-4-12(2)6-13(3,5-11)9-14(7-11,8-12)10(15)16;/h4-9H2,1-3H3,(H3,15,16);1H.
What are the key properties of 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride?
3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride has a molecular weight of 256.82 g/mol, XLogP of 3.73, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trimethyladamantane-1-carboximidamide;hydrochloride is sourced from PubChem (CID 18373599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).