C21H6Br9N3O6 — CID 18373651
1,3,5-tris(2,3,4-tribromophenoxy)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18373651) has the molecular formula C21H6Br9N3O6 and a molecular weight of 1115.43 g/mol. Its IUPAC name is 1,3,5-tris(2,3,4-tribromophenoxy)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(2,3,4-tribromophenoxy)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18373651 |
| Molecular Formula | C21H6Br9N3O6 |
| Molecular Weight | 1115.43 g/mol |
| Exact Mass | 1106.29 |
| IUPAC Name | 1,3,5-tris(2,3,4-tribromophenoxy)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(Oc2ccc(Br)c(Br)c2Br)c(=O)n(Oc2ccc(Br)c(Br)c2Br)c(=O)n1Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C21H6Br9N3O6/c22-7-1-4-10(16(28)13(7)25)37-31-19(34)32(38-11-5-2-8(23)14(26)17(11)29)21(36)33(20(31)35)39-12-6-3-9(24)15(27)18(12)30/h1-6H |
| InChIKey | UIKWOEWVZXBHPC-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.43 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|