C18H9Br24N3O3 — CID 18373673
1,3,5-tris(1,1,2,2,3,3,4,4-octabromopentyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18373673) has the molecular formula C18H9Br24N3O3 and a molecular weight of 2232.98 g/mol. Its IUPAC name is 1,3,5-tris(1,1,2,2,3,3,4,4-octabromopentyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(1,1,2,2,3,3,4,4-octabromopentyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18373673 |
| Molecular Formula | C18H9Br24N3O3 |
| Molecular Weight | 2232.98 g/mol |
| Exact Mass | 2209.10 |
| IUPAC Name | 1,3,5-tris(1,1,2,2,3,3,4,4-octabromopentyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(Br)(Br)C(Br)(Br)C(Br)(Br)C(Br)(Br)n1c(=O)n(C(Br)(Br)C(Br)(Br)C(Br)(Br)C(C)(Br)Br)c(=O)n(C(Br)(Br)C(Br)(Br)C(Br)(Br)C(C)(Br)Br)c1=O |
| InChI | InChI=1S/C18H9Br24N3O3/c1-7(19,20)10(25,26)13(31,32)16(37,38)43-4(46)44(17(39,40)14(33,34)11(27,28)8(2,21)22)6(48)45(5(43)47)18(41,42)15(35,36)12(29,30)9(3,23)24/h1-3H3 |
| InChIKey | OSNUFFXFHKJHOF-UHFFFAOYSA-N |
| XLogP | 16.81 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2232.98 |
| LogP ≤ 5 | 16.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|