C11H12O6 — CID 18374001
6a-methyl-3-methylidene-2-oxo-4,6-dihydro-3aH-cyclopenta[b]furan-5,5-dicarboxylic acid (PubChem CID 18374001) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is 6a-methyl-3-methylidene-2-oxo-4,6-dihydro-3aH-cyclopenta[b]furan-5,5-dicarboxylic acid.
| Compound Name | 6a-methyl-3-methylidene-2-oxo-4,6-dihydro-3aH-cyclopenta[b]furan-5,5-dicarboxylic acid |
|---|---|
| PubChem CID | 18374001 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6a-methyl-3-methylidene-2-oxo-4,6-dihydro-3aH-cyclopenta[b]furan-5,5-dicarboxylic acid |
| SMILES | C=C1C(=O)OC2(C)CC(C(=O)O)(C(=O)O)CC12 |
| InChI | InChI=1S/C11H12O6/c1-5-6-3-11(8(13)14,9(15)16)4-10(6,2)17-7(5)12/h6H,1,3-4H2,2H3,(H,13,14)(H,15,16) |
| InChIKey | AHLRCEHVZCMYRV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|