2-ethyl-2,3-dimethylpentanoic acid

C9H18O2 — CID 18374031

IUPAC2-ethyl-2,3-dimethylpentanoic acid
SMILESCCC(C)C(C)(CC)C(=O)O
InChIInChI=1S/C9H18O2/c1-5-7(3)9(4,6-2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11)
InChIKeyJRQAAPYJURVMJK-UHFFFAOYSA-N
MW158.24 g/mol
LogP2.53
Rot. Bonds4

About 2-ethyl-2,3-dimethylpentanoic acid

2-ethyl-2,3-dimethylpentanoic acid (PubChem CID 18374031) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-ethyl-2,3-dimethylpentanoic acid.

Molecular Properties

Compound Name2-ethyl-2,3-dimethylpentanoic acid
PubChem CID18374031
Molecular FormulaC9H18O2
Molecular Weight158.24 g/mol
Exact Mass158.13
IUPAC Name2-ethyl-2,3-dimethylpentanoic acid
SMILESCCC(C)C(C)(CC)C(=O)O
InChIInChI=1S/C9H18O2/c1-5-7(3)9(4,6-2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11)
InChIKeyJRQAAPYJURVMJK-UHFFFAOYSA-N
XLogP2.53
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.24
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-ethyl-2,3-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-2,3-dimethylpentanoic acid?
The IUPAC name of 2-ethyl-2,3-dimethylpentanoic acid (CID 18374031) is 2-ethyl-2,3-dimethylpentanoic acid.
What is the SMILES notation for 2-ethyl-2,3-dimethylpentanoic acid?
The canonical SMILES for 2-ethyl-2,3-dimethylpentanoic acid is CCC(C)C(C)(CC)C(=O)O.
What is the InChIKey of 2-ethyl-2,3-dimethylpentanoic acid?
The InChIKey is JRQAAPYJURVMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-5-7(3)9(4,6-2)8(10)11/h7H,5-6H2,1-4H3,(H,10,11).
What are the key properties of 2-ethyl-2,3-dimethylpentanoic acid?
2-ethyl-2,3-dimethylpentanoic acid has a molecular weight of 158.24 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,3-dimethylpentanoic acid is sourced from PubChem (CID 18374031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).