About hexadecan-7-yl 7,7-dimethyloctanoate
hexadecan-7-yl 7,7-dimethyloctanoate (PubChem CID 18374177) has the molecular formula C26H52O2
and a molecular weight of 396.70 g/mol. Its IUPAC name is hexadecan-7-yl 7,7-dimethyloctanoate.
Molecular Properties
| Compound Name | hexadecan-7-yl 7,7-dimethyloctanoate |
| PubChem CID | 18374177 |
| Molecular Formula | C26H52O2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.40 |
| IUPAC Name | hexadecan-7-yl 7,7-dimethyloctanoate |
| SMILES | CCCCCCCCCC(CCCCCC)OC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C26H52O2/c1-6-8-10-12-13-14-17-21-24(20-16-11-9-7-2)28-25(27)22-18-15-19-23-26(3,4)5/h24H,6-23H2,1-5H3 |
| InChIKey | JIAVUMAJCIDZOU-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-7-yl 7,7-dimethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-7-yl 7,7-dimethyloctanoate?
The IUPAC name of hexadecan-7-yl 7,7-dimethyloctanoate (CID 18374177) is hexadecan-7-yl 7,7-dimethyloctanoate.
What is the SMILES notation for hexadecan-7-yl 7,7-dimethyloctanoate?
The canonical SMILES for hexadecan-7-yl 7,7-dimethyloctanoate is CCCCCCCCCC(CCCCCC)OC(=O)CCCCCC(C)(C)C.
What is the InChIKey of hexadecan-7-yl 7,7-dimethyloctanoate?
The InChIKey is JIAVUMAJCIDZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H52O2/c1-6-8-10-12-13-14-17-21-24(20-16-11-9-7-2)28-25(27)22-18-15-19-23-26(3,4)5/h24H,6-23H2,1-5H3.
What are the key properties of hexadecan-7-yl 7,7-dimethyloctanoate?
hexadecan-7-yl 7,7-dimethyloctanoate has a molecular weight of 396.70 g/mol, XLogP of 9.01, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-7-yl 7,7-dimethyloctanoate is sourced from PubChem (CID 18374177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).