C24H24N6O — CID 18374805
8-oct-1-yn-3-yl-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18374805) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 8-oct-1-yn-3-yl-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-oct-1-yn-3-yl-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18374805 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 8-oct-1-yn-3-yl-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#CC(CCCCC)n1c(=O)ccc2cnc(Nc3ccc(-n4cccn4)cc3)nc21 |
| InChI | InChI=1S/C24H24N6O/c1-3-5-6-8-20(4-2)30-22(31)14-9-18-17-25-24(28-23(18)30)27-19-10-12-21(13-11-19)29-16-7-15-26-29/h2,7,9-17,20H,3,5-6,8H2,1H3,(H,25,27,28) |
| InChIKey | QXJNMZSHRNZTMA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|