C32H28F3N5O — CID 18374880
8-[phenyl-[2-(trifluoromethyl)phenyl]methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18374880) has the molecular formula C32H28F3N5O and a molecular weight of 555.60 g/mol. Its IUPAC name is 8-[phenyl-[2-(trifluoromethyl)phenyl]methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[phenyl-[2-(trifluoromethyl)phenyl]methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18374880 |
| Molecular Formula | C32H28F3N5O |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 8-[phenyl-[2-(trifluoromethyl)phenyl]methyl]-2-(4-piperidin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(Nc3ccc(N4CCCCC4)cc3)nc2n1C(c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C32H28F3N5O/c33-32(34,35)27-12-6-5-11-26(27)29(22-9-3-1-4-10-22)40-28(41)18-13-23-21-36-31(38-30(23)40)37-24-14-16-25(17-15-24)39-19-7-2-8-20-39/h1,3-6,9-18,21,29H,2,7-8,19-20H2,(H,36,37,38) |
| InChIKey | KPPMQXSTMWANKK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|