About 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one
8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375307) has the molecular formula C29H22N6O2
and a molecular weight of 486.54 g/mol. Its IUPAC name is 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 18375307 |
| Molecular Formula | C29H22N6O2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(Nc3ccc(-n4cccn4)cc3)nc2n1Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C29H22N6O2/c36-27-15-10-22-19-30-29(32-23-11-13-24(14-12-23)35-17-5-16-31-35)33-28(22)34(27)20-21-6-4-9-26(18-21)37-25-7-2-1-3-8-25/h1-19H,20H2,(H,30,32,33) |
| InChIKey | MNPNMJOGKSBKLP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (CID 18375307) is 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one is O=c1ccc2cnc(Nc3ccc(-n4cccn4)cc3)nc2n1Cc1cccc(Oc2ccccc2)c1.
What is the InChIKey of 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is MNPNMJOGKSBKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22N6O2/c36-27-15-10-22-19-30-29(32-23-11-13-24(14-12-23)35-17-5-16-31-35)33-28(22)34(27)20-21-6-4-9-26(18-21)37-25-7-2-1-3-8-25/h1-19H,20H2,(H,30,32,33).
What are the key properties of 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one?
8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 486.54 g/mol, XLogP of 5.56, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3-phenoxyphenyl)methyl]-2-(4-pyrazol-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 18375307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).