About 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one
2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375325) has the molecular formula C26H18F2N4O
and a molecular weight of 440.45 g/mol. Its IUPAC name is 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 18375325 |
| Molecular Formula | C26H18F2N4O |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(Nc3ccccc3)nc2n1C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H18F2N4O/c27-20-11-6-17(7-12-20)24(18-8-13-21(28)14-9-18)32-23(33)15-10-19-16-29-26(31-25(19)32)30-22-4-2-1-3-5-22/h1-16,24H,(H,29,30,31) |
| InChIKey | NMLCMTVSZONHAJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one (CID 18375325) is 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one is O=c1ccc2cnc(Nc3ccccc3)nc2n1C(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is NMLCMTVSZONHAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18F2N4O/c27-20-11-6-17(7-12-20)24(18-8-13-21(28)14-9-18)32-23(33)15-10-19-16-29-26(31-25(19)32)30-22-4-2-1-3-5-22/h1-16,24H,(H,29,30,31).
What are the key properties of 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one?
2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 440.45 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-8-[bis(4-fluorophenyl)methyl]pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 18375325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).