2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride

C10H10ClNO3S — CID 18376540

IUPAC2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride
SMILESCC(=O)N1Cc2ccc(S(=O)(=O)Cl)cc2C1
InChIInChI=1S/C10H10ClNO3S/c1-7(13)12-5-8-2-3-10(16(11,14)15)4-9(8)6-12/h2-4H,5-6H2,1H3
InChIKeyURRSOISMHKEOJC-UHFFFAOYSA-N
MW259.71 g/mol
LogP1.48
Rot. Bonds1

About 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride

2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride (PubChem CID 18376540) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride.

Molecular Properties

Compound Name2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride
PubChem CID18376540
Molecular FormulaC10H10ClNO3S
Molecular Weight259.71 g/mol
Exact Mass259.01
IUPAC Name2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride
SMILESCC(=O)N1Cc2ccc(S(=O)(=O)Cl)cc2C1
InChIInChI=1S/C10H10ClNO3S/c1-7(13)12-5-8-2-3-10(16(11,14)15)4-9(8)6-12/h2-4H,5-6H2,1H3
InChIKeyURRSOISMHKEOJC-UHFFFAOYSA-N
XLogP1.48
TPSA54.45 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.71
LogP ≤ 51.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride?
The IUPAC name of 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride (CID 18376540) is 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride.
What is the SMILES notation for 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride?
The canonical SMILES for 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride is CC(=O)N1Cc2ccc(S(=O)(=O)Cl)cc2C1.
What is the InChIKey of 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride?
The InChIKey is URRSOISMHKEOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO3S/c1-7(13)12-5-8-2-3-10(16(11,14)15)4-9(8)6-12/h2-4H,5-6H2,1H3.
What are the key properties of 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride?
2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride has a molecular weight of 259.71 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-1,3-dihydroisoindole-5-sulfonyl chloride is sourced from PubChem (CID 18376540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).