C4H6ClF3NO- — CID 18376726
3,4,4-trifluorobutanimidate;hydrochloride (PubChem CID 18376726) has the molecular formula C4H6ClF3NO- and a molecular weight of 176.55 g/mol. Its IUPAC name is 3,4,4-trifluorobutanimidate;hydrochloride.
| Compound Name | 3,4,4-trifluorobutanimidate;hydrochloride |
|---|---|
| PubChem CID | 18376726 |
| Molecular Formula | C4H6ClF3NO- |
| Molecular Weight | 176.55 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 3,4,4-trifluorobutanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\[O-])CC(F)C(F)F |
| InChI | InChI=1S/C4H6F3NO.ClH/c5-2(4(6)7)1-3(8)9;/h2,4H,1H2,(H2,8,9);1H/p-1 |
| InChIKey | BKVHPZBBFHZEBB-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.55 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|