About 2H-pyran-2,3-dicarboxylic acid
2H-pyran-2,3-dicarboxylic acid (PubChem CID 18377214) has the molecular formula C7H6O5
and a molecular weight of 170.12 g/mol. Its IUPAC name is 2H-pyran-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 2H-pyran-2,3-dicarboxylic acid |
| PubChem CID | 18377214 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 2H-pyran-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=COC1C(=O)O |
| InChI | InChI=1S/C7H6O5/c8-6(9)4-2-1-3-12-5(4)7(10)11/h1-3,5H,(H,8,9)(H,10,11) |
| InChIKey | HQGBNPXNXJHNTD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-pyran-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyran-2,3-dicarboxylic acid?
The IUPAC name of 2H-pyran-2,3-dicarboxylic acid (CID 18377214) is 2H-pyran-2,3-dicarboxylic acid.
What is the SMILES notation for 2H-pyran-2,3-dicarboxylic acid?
The canonical SMILES for 2H-pyran-2,3-dicarboxylic acid is O=C(O)C1=CC=COC1C(=O)O.
What is the InChIKey of 2H-pyran-2,3-dicarboxylic acid?
The InChIKey is HQGBNPXNXJHNTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5/c8-6(9)4-2-1-3-12-5(4)7(10)11/h1-3,5H,(H,8,9)(H,10,11).
What are the key properties of 2H-pyran-2,3-dicarboxylic acid?
2H-pyran-2,3-dicarboxylic acid has a molecular weight of 170.12 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyran-2,3-dicarboxylic acid is sourced from PubChem (CID 18377214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).