About 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 18377285) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
Analyze 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (CID 18377285) is 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is Cc1cc2c(s1)CCNC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The InChIKey is PTLTZFJYSSVFEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-6-4-7-5-9-3-2-8(7)10-6/h4,9H,2-3,5H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine has a molecular weight of 153.25 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is sourced from PubChem (CID 18377285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).