C7H13NO5 — CID 18377857
propane-1,2,3-triol;pyrrolidine-2,5-dione (PubChem CID 18377857) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is propane-1,2,3-triol;pyrrolidine-2,5-dione.
| Compound Name | propane-1,2,3-triol;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 18377857 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | propane-1,2,3-triol;pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1.OCC(O)CO |
| InChI | InChI=1S/C4H5NO2.C3H8O3/c6-3-1-2-4(7)5-3;4-1-3(6)2-5/h1-2H2,(H,5,6,7);3-6H,1-2H2 |
| InChIKey | SASGLDGKXITLFG-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|