About 2-propylhexanethioic S-acid
2-propylhexanethioic S-acid (PubChem CID 18377890) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is 2-propylhexanethioic S-acid.
Molecular Properties
| Compound Name | 2-propylhexanethioic S-acid |
| PubChem CID | 18377890 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 2-propylhexanethioic S-acid |
| SMILES | CCCCC(CCC)C(=O)S |
| InChI | InChI=1S/C9H18OS/c1-3-5-7-8(6-4-2)9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | HKNAYMZORICBLQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propylhexanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylhexanethioic S-acid?
The IUPAC name of 2-propylhexanethioic S-acid (CID 18377890) is 2-propylhexanethioic S-acid.
What is the SMILES notation for 2-propylhexanethioic S-acid?
The canonical SMILES for 2-propylhexanethioic S-acid is CCCCC(CCC)C(=O)S.
What is the InChIKey of 2-propylhexanethioic S-acid?
The InChIKey is HKNAYMZORICBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OS/c1-3-5-7-8(6-4-2)9(10)11/h8H,3-7H2,1-2H3,(H,10,11).
What are the key properties of 2-propylhexanethioic S-acid?
2-propylhexanethioic S-acid has a molecular weight of 174.31 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexanethioic S-acid is sourced from PubChem (CID 18377890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).