About 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene
2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene (PubChem CID 18377956) has the molecular formula C16H13F3
and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene.
Molecular Properties
| Compound Name | 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene |
| PubChem CID | 18377956 |
| Molecular Formula | C16H13F3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene |
| SMILES | Cc1ccc2c(c1)CCc1cc(C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C16H13F3/c1-10-2-6-14-11(8-10)3-4-12-9-13(16(17,18)19)5-7-15(12)14/h2,5-9H,3-4H2,1H3 |
| InChIKey | XAHDLJKPSAKKEE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene?
The IUPAC name of 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene (CID 18377956) is 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene.
What is the SMILES notation for 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene?
The canonical SMILES for 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene is Cc1ccc2c(c1)CCc1cc(C(F)(F)F)ccc1-2.
What is the InChIKey of 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene?
The InChIKey is XAHDLJKPSAKKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3/c1-10-2-6-14-11(8-10)3-4-12-9-13(16(17,18)19)5-7-15(12)14/h2,5-9H,3-4H2,1H3.
What are the key properties of 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene?
2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene has a molecular weight of 262.27 g/mol, XLogP of 4.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-(trifluoromethyl)-9,10-dihydrophenanthrene is sourced from PubChem (CID 18377956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).