About (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate
(octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate (PubChem CID 18378243) has the molecular formula C17H25F3NO5P
and a molecular weight of 411.36 g/mol. Its IUPAC name is (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate.
Molecular Properties
| Compound Name | (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate |
| PubChem CID | 18378243 |
| Molecular Formula | C17H25F3NO5P |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate |
| SMILES | CCCCCCCC(=O)NOP(=O)(O)OCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3NO5P/c1-2-3-4-5-6-7-16(22)21-26-27(23,24)25-13-12-14-8-10-15(11-9-14)17(18,19)20/h8-11H,2-7,12-13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | ZJKBRLMTCFFGEP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate?
The IUPAC name of (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate (CID 18378243) is (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate.
What is the SMILES notation for (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate?
The canonical SMILES for (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate is CCCCCCCC(=O)NOP(=O)(O)OCCc1ccc(C(F)(F)F)cc1.
What is the InChIKey of (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate?
The InChIKey is ZJKBRLMTCFFGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F3NO5P/c1-2-3-4-5-6-7-16(22)21-26-27(23,24)25-13-12-14-8-10-15(11-9-14)17(18,19)20/h8-11H,2-7,12-13H2,1H3,(H,21,22)(H,23,24).
What are the key properties of (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate?
(octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate has a molecular weight of 411.36 g/mol, XLogP of 4.77, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (octanoylamino) 2-[4-(trifluoromethyl)phenyl]ethyl hydrogen phosphate is sourced from PubChem (CID 18378243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).