C17H16N2O — CID 18378699
15-methoxy-11,16-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene (PubChem CID 18378699) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 15-methoxy-11,16-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene.
| Compound Name | 15-methoxy-11,16-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene |
|---|---|
| PubChem CID | 18378699 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 15-methoxy-11,16-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2,4,6,12(17),13,15-heptaene |
| SMILES | COc1ccc2c(cc3n2CCCc2ccccc2-3)n1 |
| InChI | InChI=1S/C17H16N2O/c1-20-17-9-8-15-14(18-17)11-16-13-7-3-2-5-12(13)6-4-10-19(15)16/h2-3,5,7-9,11H,4,6,10H2,1H3 |
| InChIKey | IRWUJTVAKSSBQL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |