C23H28ClN3O3S — CID 18378891
7-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]heptanoic acid (PubChem CID 18378891) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is 7-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]heptanoic acid.
| Compound Name | 7-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 18378891 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 7-[4-[(3-chloro-4-methoxyphenyl)methylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]heptanoic acid |
| SMILES | COc1ccc(CNc2nc(CCCCCCC(=O)O)nc3sc(C)c(C)c23)cc1Cl |
| InChI | InChI=1S/C23H28ClN3O3S/c1-14-15(2)31-23-21(14)22(25-13-16-10-11-18(30-3)17(24)12-16)26-19(27-23)8-6-4-5-7-9-20(28)29/h10-12H,4-9,13H2,1-3H3,(H,28,29)(H,25,26,27) |
| InChIKey | IHYIIUJPXFDZLK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|