C29H29F3N4O6 — CID 18379037
N-[4-[2-(hydroxyamino)-2-oxoethyl]oxan-4-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 18379037) has the molecular formula C29H29F3N4O6 and a molecular weight of 586.57 g/mol. Its IUPAC name is N-[4-[2-(hydroxyamino)-2-oxoethyl]oxan-4-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]oxan-4-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18379037 |
| Molecular Formula | C29H29F3N4O6 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]oxan-4-yl]-1-[(2-methylquinolin-4-yl)methyl]indole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(Cn2ccc3cc(C(=O)NC4(CC(=O)NO)CCOCC4)ccc32)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H28N4O4.C2HF3O2/c1-18-14-21(22-4-2-3-5-23(22)28-18)17-31-11-8-19-15-20(6-7-24(19)31)26(33)29-27(16-25(32)30-34)9-12-35-13-10-27;3-2(4,5)1(6)7/h2-8,11,14-15,34H,9-10,12-13,16-17H2,1H3,(H,29,33)(H,30,32);(H,6,7) |
| InChIKey | LTVPTZOYUOJRKT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|