About 1,4-dioxane;trimethoxymethane
1,4-dioxane;trimethoxymethane (PubChem CID 18379719) has the molecular formula C8H18O5
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,4-dioxane;trimethoxymethane.
Molecular Properties
| Compound Name | 1,4-dioxane;trimethoxymethane |
| PubChem CID | 18379719 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1,4-dioxane;trimethoxymethane |
| SMILES | C1COCCO1.COC(OC)OC |
| InChI | InChI=1S/C4H10O3.C4H8O2/c1-5-4(6-2)7-3;1-2-6-4-3-5-1/h4H,1-3H3;1-4H2 |
| InChIKey | ORDIHHNPUBIGML-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxane;trimethoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;trimethoxymethane?
The IUPAC name of 1,4-dioxane;trimethoxymethane (CID 18379719) is 1,4-dioxane;trimethoxymethane.
What is the SMILES notation for 1,4-dioxane;trimethoxymethane?
The canonical SMILES for 1,4-dioxane;trimethoxymethane is C1COCCO1.COC(OC)OC.
What is the InChIKey of 1,4-dioxane;trimethoxymethane?
The InChIKey is ORDIHHNPUBIGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3.C4H8O2/c1-5-4(6-2)7-3;1-2-6-4-3-5-1/h4H,1-3H3;1-4H2.
What are the key properties of 1,4-dioxane;trimethoxymethane?
1,4-dioxane;trimethoxymethane has a molecular weight of 194.23 g/mol, XLogP of 0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;trimethoxymethane is sourced from PubChem (CID 18379719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).