About 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine
1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine (PubChem CID 18379887) has the molecular formula C15H19N5
and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine |
| PubChem CID | 18379887 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine |
| SMILES | c1cc2c(cc1NC1=NCCN1)ncn2C1CCCC1 |
| InChI | InChI=1S/C15H19N5/c1-2-4-12(3-1)20-10-18-13-9-11(5-6-14(13)20)19-15-16-7-8-17-15/h5-6,9-10,12H,1-4,7-8H2,(H2,16,17,19) |
| InChIKey | RSYUXGLGJABLFJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine?
The IUPAC name of 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine (CID 18379887) is 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine.
What is the SMILES notation for 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine?
The canonical SMILES for 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine is c1cc2c(cc1NC1=NCCN1)ncn2C1CCCC1.
What is the InChIKey of 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine?
The InChIKey is RSYUXGLGJABLFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5/c1-2-4-12(3-1)20-10-18-13-9-11(5-6-14(13)20)19-15-16-7-8-17-15/h5-6,9-10,12H,1-4,7-8H2,(H2,16,17,19).
What are the key properties of 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine?
1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine has a molecular weight of 269.35 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-(4,5-dihydro-1H-imidazol-2-yl)benzimidazol-5-amine is sourced from PubChem (CID 18379887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).