C30H27NO4 — CID 18380414
1-(4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl)-2-[5-(4-phenylphenyl)furan-2-yl]ethane-1,2-dione (PubChem CID 18380414) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-(4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl)-2-[5-(4-phenylphenyl)furan-2-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl)-2-[5-(4-phenylphenyl)furan-2-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 18380414 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 1-(4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl)-2-[5-(4-phenylphenyl)furan-2-yl]ethane-1,2-dione |
| SMILES | CC1(C)OCC(Cc2ccccc2)N1C(=O)C(=O)c1ccc(-c2ccc(-c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C30H27NO4/c1-30(2)31(25(20-34-30)19-21-9-5-3-6-10-21)29(33)28(32)27-18-17-26(35-27)24-15-13-23(14-16-24)22-11-7-4-8-12-22/h3-18,25H,19-20H2,1-2H3 |
| InChIKey | HUJPMBFKBLJBON-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|