About 6-methylhept-5-ene-2,3-diamine
6-methylhept-5-ene-2,3-diamine (PubChem CID 18380626) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 6-methylhept-5-ene-2,3-diamine.
Molecular Properties
| Compound Name | 6-methylhept-5-ene-2,3-diamine |
| PubChem CID | 18380626 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 6-methylhept-5-ene-2,3-diamine |
| SMILES | CC(C)=CCC(N)C(C)N |
| InChI | InChI=1S/C8H18N2/c1-6(2)4-5-8(10)7(3)9/h4,7-8H,5,9-10H2,1-3H3 |
| InChIKey | RWYFZGRFSGLVTO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-5-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-5-ene-2,3-diamine?
The IUPAC name of 6-methylhept-5-ene-2,3-diamine (CID 18380626) is 6-methylhept-5-ene-2,3-diamine.
What is the SMILES notation for 6-methylhept-5-ene-2,3-diamine?
The canonical SMILES for 6-methylhept-5-ene-2,3-diamine is CC(C)=CCC(N)C(C)N.
What is the InChIKey of 6-methylhept-5-ene-2,3-diamine?
The InChIKey is RWYFZGRFSGLVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-6(2)4-5-8(10)7(3)9/h4,7-8H,5,9-10H2,1-3H3.
What are the key properties of 6-methylhept-5-ene-2,3-diamine?
6-methylhept-5-ene-2,3-diamine has a molecular weight of 142.25 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-5-ene-2,3-diamine is sourced from PubChem (CID 18380626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).