C22H38N2O6Si — CID 18381376
tert-butyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-1-cyano-2-hydroxyethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 18381376) has the molecular formula C22H38N2O6Si and a molecular weight of 454.64 g/mol. Its IUPAC name is tert-butyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-1-cyano-2-hydroxyethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-1-cyano-2-hydroxyethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 18381376 |
| Molecular Formula | C22H38N2O6Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | tert-butyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-1-cyano-2-hydroxyethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CO[Si](C)(C)C(C)(C)C)C2OC(C)(C)OC2C1/C(C#N)=C/O |
| InChI | InChI=1S/C22H38N2O6Si/c1-20(2,3)30-19(26)24-15(13-27-31(9,10)21(4,5)6)17-18(29-22(7,8)28-17)16(24)14(11-23)12-25/h12,15-18,25H,13H2,1-10H3/b14-12+ |
| InChIKey | JXRVZIDPWUDVAH-WYMLVPIESA-N |
| XLogP | 4.48 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|