About 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile
3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile (PubChem CID 18382006) has the molecular formula C24H22N4O2
and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile |
| PubChem CID | 18382006 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CC3CCN(CCN4C(=O)c5ccccc5C4=O)C3)c2c1 |
| InChI | InChI=1S/C24H22N4O2/c25-13-16-5-6-22-21(12-16)18(14-26-22)11-17-7-8-27(15-17)9-10-28-23(29)19-3-1-2-4-20(19)24(28)30/h1-6,12,14,17,26H,7-11,15H2 |
| InChIKey | NVBMKBGUAPOFGC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile?
The IUPAC name of 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile (CID 18382006) is 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile?
The canonical SMILES for 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile is N#Cc1ccc2[nH]cc(CC3CCN(CCN4C(=O)c5ccccc5C4=O)C3)c2c1.
What is the InChIKey of 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile?
The InChIKey is NVBMKBGUAPOFGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O2/c25-13-16-5-6-22-21(12-16)18(14-26-22)11-17-7-8-27(15-17)9-10-28-23(29)19-3-1-2-4-20(19)24(28)30/h1-6,12,14,17,26H,7-11,15H2.
What are the key properties of 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile?
3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile has a molecular weight of 398.47 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrrolidin-3-yl]methyl]-1H-indole-5-carbonitrile is sourced from PubChem (CID 18382006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).