C12H15ClN2O2 — CID 18382543
5-chloro-1,1,2-trimethyl-7-nitro-3,4-dihydroisoquinoline (PubChem CID 18382543) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-chloro-1,1,2-trimethyl-7-nitro-3,4-dihydroisoquinoline.
| Compound Name | 5-chloro-1,1,2-trimethyl-7-nitro-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 18382543 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-chloro-1,1,2-trimethyl-7-nitro-3,4-dihydroisoquinoline |
| SMILES | CN1CCc2c(Cl)cc([N+](=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C12H15ClN2O2/c1-12(2)10-6-8(15(16)17)7-11(13)9(10)4-5-14(12)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | SGTUPVYYOUUQPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|