About 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine
2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine (PubChem CID 18382880) has the molecular formula C23H16N4OS
and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine |
| PubChem CID | 18382880 |
| Molecular Formula | C23H16N4OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1cc2cc(Nc3ccnc4cc(-c5nc6ccccc6o5)sc34)ccc2[nH]1 |
| InChI | InChI=1S/C23H16N4OS/c1-13-10-14-11-15(6-7-16(14)25-13)26-18-8-9-24-19-12-21(29-22(18)19)23-27-17-4-2-3-5-20(17)28-23/h2-12,25H,1H3,(H,24,26) |
| InChIKey | GAFWXOWNUHBYBF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine?
The IUPAC name of 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine (CID 18382880) is 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine?
The canonical SMILES for 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine is Cc1cc2cc(Nc3ccnc4cc(-c5nc6ccccc6o5)sc34)ccc2[nH]1.
What is the InChIKey of 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine?
The InChIKey is GAFWXOWNUHBYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4OS/c1-13-10-14-11-15(6-7-16(14)25-13)26-18-8-9-24-19-12-21(29-22(18)19)23-27-17-4-2-3-5-20(17)28-23/h2-12,25H,1H3,(H,24,26).
What are the key properties of 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine?
2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine has a molecular weight of 396.48 g/mol, XLogP of 6.64, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-yl)-N-(2-methyl-1H-indol-5-yl)thieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 18382880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).