C25H24N6OS — CID 18382946
N-[2-[[4-[4-(1H-indol-5-ylamino)thieno[3,2-d]pyrimidin-6-yl]phenyl]methylamino]ethyl]acetamide (PubChem CID 18382946) has the molecular formula C25H24N6OS and a molecular weight of 456.58 g/mol. Its IUPAC name is N-[2-[[4-[4-(1H-indol-5-ylamino)thieno[3,2-d]pyrimidin-6-yl]phenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-[4-(1H-indol-5-ylamino)thieno[3,2-d]pyrimidin-6-yl]phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 18382946 |
| Molecular Formula | C25H24N6OS |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[2-[[4-[4-(1H-indol-5-ylamino)thieno[3,2-d]pyrimidin-6-yl]phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(-c2cc3ncnc(Nc4ccc5[nH]ccc5c4)c3s2)cc1 |
| InChI | InChI=1S/C25H24N6OS/c1-16(32)27-11-10-26-14-17-2-4-18(5-3-17)23-13-22-24(33-23)25(30-15-29-22)31-20-6-7-21-19(12-20)8-9-28-21/h2-9,12-13,15,26,28H,10-11,14H2,1H3,(H,27,32)(H,29,30,31) |
| InChIKey | PDLBTPKSQYCOOT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|