C21H25N3O3S2 — CID 18383794
N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenyl)sulfanylbenzamide (PubChem CID 18383794) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenyl)sulfanylbenzamide.
| Compound Name | N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 18383794 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenyl)sulfanylbenzamide |
| SMILES | CC1C(NC(=O)c2ccc(Sc3ccccc3S(N)(=O)=O)cc2)C2CCN1CC2 |
| InChI | InChI=1S/C21H25N3O3S2/c1-14-20(15-10-12-24(14)13-11-15)23-21(25)16-6-8-17(9-7-16)28-18-4-2-3-5-19(18)29(22,26)27/h2-9,14-15,20H,10-13H2,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | PWMGEIHVOZFWQW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |